About (Z)-N',N'-diethylbut-2-enediamide
(Z)-N',N'-diethylbut-2-enediamide (PubChem CID 87299001) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is (Z)-N',N'-diethylbut-2-enediamide.
Molecular Properties
| Compound Name | (Z)-N',N'-diethylbut-2-enediamide |
| PubChem CID | 87299001 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (Z)-N',N'-diethylbut-2-enediamide |
| SMILES | CCN(CC)C(=O)/C=C\C(N)=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-10(4-2)8(12)6-5-7(9)11/h5-6H,3-4H2,1-2H3,(H2,9,11)/b6-5- |
| InChIKey | NAXMCPXRGLEFDW-WAYWQWQTSA-N |
| XLogP | -0.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N',N'-diethylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N',N'-diethylbut-2-enediamide?
The IUPAC name of (Z)-N',N'-diethylbut-2-enediamide (CID 87299001) is (Z)-N',N'-diethylbut-2-enediamide.
What is the SMILES notation for (Z)-N',N'-diethylbut-2-enediamide?
The canonical SMILES for (Z)-N',N'-diethylbut-2-enediamide is CCN(CC)C(=O)/C=C\C(N)=O.
What is the InChIKey of (Z)-N',N'-diethylbut-2-enediamide?
The InChIKey is NAXMCPXRGLEFDW-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-3-10(4-2)8(12)6-5-7(9)11/h5-6H,3-4H2,1-2H3,(H2,9,11)/b6-5-.
What are the key properties of (Z)-N',N'-diethylbut-2-enediamide?
(Z)-N',N'-diethylbut-2-enediamide has a molecular weight of 170.21 g/mol, XLogP of -0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N',N'-diethylbut-2-enediamide is sourced from PubChem (CID 87299001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).