About 2-hydroxyethylazanium;2-hydroxypropanoate
2-hydroxyethylazanium;2-hydroxypropanoate (PubChem CID 87299033) has the molecular formula C5H13NO4
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-hydroxyethylazanium;2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-hydroxyethylazanium;2-hydroxypropanoate |
| PubChem CID | 87299033 |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2-hydroxyethylazanium;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].[NH3+]CCO |
| InChI | InChI=1S/C3H6O3.C2H7NO/c1-2(4)3(5)6;3-1-2-4/h2,4H,1H3,(H,5,6);4H,1-3H2 |
| InChIKey | NEQXUPRFDXNNTA-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxyethylazanium;2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethylazanium;2-hydroxypropanoate?
The IUPAC name of 2-hydroxyethylazanium;2-hydroxypropanoate (CID 87299033) is 2-hydroxyethylazanium;2-hydroxypropanoate.
What is the SMILES notation for 2-hydroxyethylazanium;2-hydroxypropanoate?
The canonical SMILES for 2-hydroxyethylazanium;2-hydroxypropanoate is CC(O)C(=O)[O-].[NH3+]CCO.
What is the InChIKey of 2-hydroxyethylazanium;2-hydroxypropanoate?
The InChIKey is NEQXUPRFDXNNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H7NO/c1-2(4)3(5)6;3-1-2-4/h2,4H,1H3,(H,5,6);4H,1-3H2.
What are the key properties of 2-hydroxyethylazanium;2-hydroxypropanoate?
2-hydroxyethylazanium;2-hydroxypropanoate has a molecular weight of 151.16 g/mol, XLogP of -3.66, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethylazanium;2-hydroxypropanoate is sourced from PubChem (CID 87299033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).