C17H10F10N4 — CID 87299036
2-(4-amino-3-methylphenyl)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]acetonitrile (PubChem CID 87299036) has the molecular formula C17H10F10N4 and a molecular weight of 460.28 g/mol. Its IUPAC name is 2-(4-amino-3-methylphenyl)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]acetonitrile.
| Compound Name | 2-(4-amino-3-methylphenyl)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 87299036 |
| Molecular Formula | C17H10F10N4 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-(4-amino-3-methylphenyl)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]acetonitrile |
| SMILES | Cc1cc(C(C#N)c2nc(C(F)(F)C(F)(F)F)cc(C(F)(F)C(F)(F)F)n2)ccc1N |
| InChI | InChI=1S/C17H10F10N4/c1-7-4-8(2-3-10(7)29)9(6-28)13-30-11(14(18,19)16(22,23)24)5-12(31-13)15(20,21)17(25,26)27/h2-5,9H,29H2,1H3 |
| InChIKey | ODOQKFVAFFQYCL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|