C14H8F10N4O2 — CID 87299323
6-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methyl-3-nitropyridine (PubChem CID 87299323) has the molecular formula C14H8F10N4O2 and a molecular weight of 454.22 g/mol. Its IUPAC name is 6-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methyl-3-nitropyridine.
| Compound Name | 6-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methyl-3-nitropyridine |
|---|---|
| PubChem CID | 87299323 |
| Molecular Formula | C14H8F10N4O2 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 6-[[3,4-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methyl-3-nitropyridine |
| SMILES | Cc1nc(Cn2cc(C(F)(F)C(F)(F)F)c(C(F)(F)C(F)(F)F)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F10N4O2/c1-6-9(28(29)30)3-2-7(25-6)4-27-5-8(11(15,16)13(19,20)21)10(26-27)12(17,18)14(22,23)24/h2-3,5H,4H2,1H3 |
| InChIKey | CDNHCSHQXQHDIR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|