About 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine
2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine (PubChem CID 87299437) has the molecular formula C10H21NO7
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine.
Molecular Properties
| Compound Name | 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine |
| PubChem CID | 87299437 |
| Molecular Formula | C10H21NO7 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCOC.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C6H15NO2.C4H6O5/c1-8-5-3-7-4-6-9-2;5-2(4(8)9)1-3(6)7/h7H,3-6H2,1-2H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | WRORYEVIGQEQRL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine?
The IUPAC name of 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine (CID 87299437) is 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine.
What is the SMILES notation for 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine?
The canonical SMILES for 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine is COCCNCCOC.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine?
The InChIKey is WRORYEVIGQEQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.C4H6O5/c1-8-5-3-7-4-6-9-2;5-2(4(8)9)1-3(6)7/h7H,3-6H2,1-2H3;2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine?
2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine has a molecular weight of 267.28 g/mol, XLogP of -1.22, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid;2-methoxy-N-(2-methoxyethyl)ethanamine is sourced from PubChem (CID 87299437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).