C12H5F5N2O3S — CID 87299457
(4-nitrophenyl)-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]methanone (PubChem CID 87299457) has the molecular formula C12H5F5N2O3S and a molecular weight of 352.24 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]methanone.
| Compound Name | (4-nitrophenyl)-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]methanone |
|---|---|
| PubChem CID | 87299457 |
| Molecular Formula | C12H5F5N2O3S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (4-nitrophenyl)-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H5F5N2O3S/c13-11(14,12(15,16)17)8-5-23-10(18-8)9(20)6-1-3-7(4-2-6)19(21)22/h1-5H |
| InChIKey | NCJMKMXJMFCIKJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|