C15H11F8N3O — CID 87299524
1-[1-[(4-amino-3-methylphenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 87299524) has the molecular formula C15H11F8N3O and a molecular weight of 401.26 g/mol. Its IUPAC name is 1-[1-[(4-amino-3-methylphenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-[(4-amino-3-methylphenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87299524 |
| Molecular Formula | C15H11F8N3O |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 1-[1-[(4-amino-3-methylphenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | Cc1cc(Cn2nc(C(F)(F)C(F)(F)F)cc2C(=O)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C15H11F8N3O/c1-7-4-8(2-3-9(7)24)6-26-10(12(27)14(18,19)20)5-11(25-26)13(16,17)15(21,22)23/h2-5H,6,24H2,1H3 |
| InChIKey | TZEMNMMXXQICOT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|