About hexyl undecyl carbonate
hexyl undecyl carbonate (PubChem CID 87299622) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is hexyl undecyl carbonate.
Molecular Properties
| Compound Name | hexyl undecyl carbonate |
| PubChem CID | 87299622 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | hexyl undecyl carbonate |
| SMILES | CCCCCCCCCCCOC(=O)OCCCCCC |
| InChI | InChI=1S/C18H36O3/c1-3-5-7-9-10-11-12-13-15-17-21-18(19)20-16-14-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | MHEDTFAJTDSAGE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl undecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl undecyl carbonate?
The IUPAC name of hexyl undecyl carbonate (CID 87299622) is hexyl undecyl carbonate.
What is the SMILES notation for hexyl undecyl carbonate?
The canonical SMILES for hexyl undecyl carbonate is CCCCCCCCCCCOC(=O)OCCCCCC.
What is the InChIKey of hexyl undecyl carbonate?
The InChIKey is MHEDTFAJTDSAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3/c1-3-5-7-9-10-11-12-13-15-17-21-18(19)20-16-14-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of hexyl undecyl carbonate?
hexyl undecyl carbonate has a molecular weight of 300.48 g/mol, XLogP of 6.25, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl undecyl carbonate is sourced from PubChem (CID 87299622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).