C11H7ClF6N4 — CID 87299785
2-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-4-chloroaniline (PubChem CID 87299785) has the molecular formula C11H7ClF6N4 and a molecular weight of 344.65 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-4-chloroaniline.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-4-chloroaniline |
|---|---|
| PubChem CID | 87299785 |
| Molecular Formula | C11H7ClF6N4 |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]-4-chloroaniline |
| SMILES | Nc1ccc(Cl)cc1Cn1nc(C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C11H7ClF6N4/c12-6-1-2-7(19)5(3-6)4-22-9(11(16,17)18)20-8(21-22)10(13,14)15/h1-3H,4,19H2 |
| InChIKey | JWHCTTDXDUZBOJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|