C27H36N6O6 — CID 87300081
7-[7-methyl-8-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid (PubChem CID 87300081) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 7-[7-methyl-8-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid.
| Compound Name | 7-[7-methyl-8-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid |
|---|---|
| PubChem CID | 87300081 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 7-[7-methyl-8-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-2,4-dioxobenzo[g]pteridin-10-yl]heptanoic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCCCC(=O)O)c2cc1N[C@]1(C(=O)OC(C)(C)C)CCNC1 |
| InChI | InChI=1S/C27H36N6O6/c1-16-13-18-19(14-17(16)32-27(10-11-28-15-27)24(37)39-26(2,3)4)33(12-8-6-5-7-9-20(34)35)22-21(29-18)23(36)31-25(38)30-22/h13-14,28,32H,5-12,15H2,1-4H3,(H,34,35)(H,31,36,38)/t27-/m1/s1 |
| InChIKey | OKCCQDVKIMYNLL-HHHXNRCGSA-N |
| XLogP | 2.41 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|