About 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one
4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one (PubChem CID 87300308) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one.
Molecular Properties
| Compound Name | 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one |
| PubChem CID | 87300308 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one |
| SMILES | CC(=O)C=C(C)C.CSC(C)CC(C)=O |
| InChI | InChI=1S/C6H12OS.C6H10O/c1-5(7)4-6(2)8-3;1-5(2)4-6(3)7/h6H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | JWZSRTDBKFTNPL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one?
The IUPAC name of 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one (CID 87300308) is 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one.
What is the SMILES notation for 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one?
The canonical SMILES for 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one is CC(=O)C=C(C)C.CSC(C)CC(C)=O.
What is the InChIKey of 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one?
The InChIKey is JWZSRTDBKFTNPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS.C6H10O/c1-5(7)4-6(2)8-3;1-5(2)4-6(3)7/h6H,4H2,1-3H3;4H,1-3H3.
What are the key properties of 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one?
4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one has a molecular weight of 230.37 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpent-3-en-2-one;4-methylsulfanylpentan-2-one is sourced from PubChem (CID 87300308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).