About 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid
2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid (PubChem CID 87300892) has the molecular formula C12H14BBrN2O2
and a molecular weight of 308.97 g/mol. Its IUPAC name is 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid.
Molecular Properties
| Compound Name | 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid |
| PubChem CID | 87300892 |
| Molecular Formula | C12H14BBrN2O2 |
| Molecular Weight | 308.97 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid |
| SMILES | Cc1ccc(B(O)O)nc1.Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C6H8BNO2.C6H6BrN/c1-5-2-3-6(7(9)10)8-4-5;1-5-2-3-6(7)8-4-5/h2-4,9-10H,1H3;2-4H,1H3 |
| InChIKey | XSMBLENSGJJCHX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.97 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid?
The IUPAC name of 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid (CID 87300892) is 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid.
What is the SMILES notation for 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid?
The canonical SMILES for 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid is Cc1ccc(B(O)O)nc1.Cc1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid?
The InChIKey is XSMBLENSGJJCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BNO2.C6H6BrN/c1-5-2-3-6(7(9)10)8-4-5;1-5-2-3-6(7)8-4-5/h2-4,9-10H,1H3;2-4H,1H3.
What are the key properties of 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid?
2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid has a molecular weight of 308.97 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-methylpyridine;(5-methyl-2-pyridinyl)boronic acid is sourced from PubChem (CID 87300892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).