About [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate
[6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate (PubChem CID 87300927) has the molecular formula C28H26N2O6
and a molecular weight of 486.52 g/mol. Its IUPAC name is [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate.
Molecular Properties
| Compound Name | [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate |
| PubChem CID | 87300927 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate |
| SMILES | COc1ccc(-c2ccc(CCC(OC=O)C(C=O)CCN3C(=O)c4ccccc4C3=O)cc2)cn1 |
| InChI | InChI=1S/C28H26N2O6/c1-35-26-13-11-21(16-29-26)20-9-6-19(7-10-20)8-12-25(36-18-32)22(17-31)14-15-30-27(33)23-4-2-3-5-24(23)28(30)34/h2-7,9-11,13,16-18,22,25H,8,12,14-15H2,1H3 |
| InChIKey | WCANSRWKEBJZOJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate?
The IUPAC name of [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate (CID 87300927) is [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate.
What is the SMILES notation for [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate?
The canonical SMILES for [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate is COc1ccc(-c2ccc(CCC(OC=O)C(C=O)CCN3C(=O)c4ccccc4C3=O)cc2)cn1.
What is the InChIKey of [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate?
The InChIKey is WCANSRWKEBJZOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O6/c1-35-26-13-11-21(16-29-26)20-9-6-19(7-10-20)8-12-25(36-18-32)22(17-31)14-15-30-27(33)23-4-2-3-5-24(23)28(30)34/h2-7,9-11,13,16-18,22,25H,8,12,14-15H2,1H3.
What are the key properties of [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate?
[6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate has a molecular weight of 486.52 g/mol, XLogP of 3.73, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,3-dioxoisoindol-2-yl)-4-formyl-1-[4-(6-methoxy-3-pyridinyl)phenyl]hexan-3-yl] formate is sourced from PubChem (CID 87300927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).