About (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid
(2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid (PubChem CID 87301058) has the molecular formula C10H10O11
and a molecular weight of 306.18 g/mol. Its IUPAC name is (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid.
Molecular Properties
| Compound Name | (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid |
| PubChem CID | 87301058 |
| Molecular Formula | C10H10O11 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid |
| SMILES | O=C(O)C/C(=C/C(=O)OC(C(=O)O)C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H10O11/c11-4(12)1-3(8(15)16)2-5(13)21-7(10(19)20)6(14)9(17)18/h2,6-7,14H,1H2,(H,11,12)(H,15,16)(H,17,18)(H,19,20)/b3-2- |
| InChIKey | RKWSYNDOPMZPDE-IHWYPQMZSA-N |
| XLogP | -2.09 |
| TPSA | 195.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid?
The IUPAC name of (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid (CID 87301058) is (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid.
What is the SMILES notation for (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid?
The canonical SMILES for (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid is O=C(O)C/C(=C/C(=O)OC(C(=O)O)C(O)C(=O)O)C(=O)O.
What is the InChIKey of (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid?
The InChIKey is RKWSYNDOPMZPDE-IHWYPQMZSA-N. The full InChI is InChI=1S/C10H10O11/c11-4(12)1-3(8(15)16)2-5(13)21-7(10(19)20)6(14)9(17)18/h2,6-7,14H,1H2,(H,11,12)(H,15,16)(H,17,18)(H,19,20)/b3-2-.
What are the key properties of (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid?
(2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid has a molecular weight of 306.18 g/mol, XLogP of -2.09, 8 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethylidene]butanedioic acid is sourced from PubChem (CID 87301058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).