C10H3Br2F9 — CID 87301204
1,3-dibromo-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 87301204) has the molecular formula C10H3Br2F9 and a molecular weight of 453.92 g/mol. Its IUPAC name is 1,3-dibromo-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 1,3-dibromo-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 87301204 |
| Molecular Formula | C10H3Br2F9 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 451.85 |
| IUPAC Name | 1,3-dibromo-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(c1cc(Br)cc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C10H3Br2F9/c11-5-1-4(2-6(12)3-5)7(13,9(16,17)18)8(14,15)10(19,20)21/h1-3H |
| InChIKey | NHHSVVYXLQLMJJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|