C20H22Cl2F3N3O — CID 87301429
2-chloro-N-[4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide (PubChem CID 87301429) has the molecular formula C20H22Cl2F3N3O and a molecular weight of 448.32 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide.
| Compound Name | 2-chloro-N-[4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 87301429 |
| Molecular Formula | C20H22Cl2F3N3O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-chloro-N-[4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide |
| SMILES | Cc1nn(CC2CCC(NC(=O)c3c(F)c(C)c(F)c(F)c3Cl)CC2)c(C)c1Cl |
| InChI | InChI=1S/C20H22Cl2F3N3O/c1-9-17(23)14(16(22)19(25)18(9)24)20(29)26-13-6-4-12(5-7-13)8-28-11(3)15(21)10(2)27-28/h12-13H,4-8H2,1-3H3,(H,26,29) |
| InChIKey | ACOINRFKRAQEAR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|