C22H32ClN5O3S — CID 87301563
tert-butyl 2-[(5-chloro-7-morpholin-4-yl-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 87301563) has the molecular formula C22H32ClN5O3S and a molecular weight of 482.05 g/mol. Its IUPAC name is tert-butyl 2-[(5-chloro-7-morpholin-4-yl-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[(5-chloro-7-morpholin-4-yl-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 87301563 |
| Molecular Formula | C22H32ClN5O3S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | tert-butyl 2-[(5-chloro-7-morpholin-4-yl-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(Cc3nc4c(s3)CN(Cl)C=C4N3CCOCC3)CC2C1 |
| InChI | InChI=1S/C22H32ClN5O3S/c1-22(2,3)31-21(29)27-10-15-8-25(9-16(15)11-27)14-19-24-20-17(26-4-6-30-7-5-26)12-28(23)13-18(20)32-19/h12,15-16H,4-11,13-14H2,1-3H3 |
| InChIKey | XWULMBIQUXZJFB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|