About 2,4-diphenoxybenzaldehyde
2,4-diphenoxybenzaldehyde (PubChem CID 87301631) has the molecular formula C19H14O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,4-diphenoxybenzaldehyde.
Molecular Properties
| Compound Name | 2,4-diphenoxybenzaldehyde |
| PubChem CID | 87301631 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,4-diphenoxybenzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccccc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C19H14O3/c20-14-15-11-12-18(21-16-7-3-1-4-8-16)13-19(15)22-17-9-5-2-6-10-17/h1-14H |
| InChIKey | QBPUUQGTTYSBCR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diphenoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenoxybenzaldehyde?
The IUPAC name of 2,4-diphenoxybenzaldehyde (CID 87301631) is 2,4-diphenoxybenzaldehyde.
What is the SMILES notation for 2,4-diphenoxybenzaldehyde?
The canonical SMILES for 2,4-diphenoxybenzaldehyde is O=Cc1ccc(Oc2ccccc2)cc1Oc1ccccc1.
What is the InChIKey of 2,4-diphenoxybenzaldehyde?
The InChIKey is QBPUUQGTTYSBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O3/c20-14-15-11-12-18(21-16-7-3-1-4-8-16)13-19(15)22-17-9-5-2-6-10-17/h1-14H.
What are the key properties of 2,4-diphenoxybenzaldehyde?
2,4-diphenoxybenzaldehyde has a molecular weight of 290.32 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenoxybenzaldehyde is sourced from PubChem (CID 87301631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).