C17H18N2O6 — CID 8730167
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8730167) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8730167 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)O[C@H](C(=O)NC(N)=O)C(C)C)cc(=O)c2c1 |
| InChI | InChI=1S/C17H18N2O6/c1-8(2)14(15(21)19-17(18)23)25-16(22)13-7-11(20)10-6-9(3)4-5-12(10)24-13/h4-8,14H,1-3H3,(H3,18,19,21,23)/t14-/m0/s1 |
| InChIKey | LYNGQDXRABTQRN-AWEZNQCLSA-N |
| XLogP | 1.48 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |