C10H13N3OS2 — CID 87301721
2-morpholin-4-yl-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridine-4-thione (PubChem CID 87301721) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-morpholin-4-yl-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridine-4-thione.
| Compound Name | 2-morpholin-4-yl-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridine-4-thione |
|---|---|
| PubChem CID | 87301721 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-morpholin-4-yl-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridine-4-thione |
| SMILES | S=C1NCCc2nc(N3CCOCC3)sc21 |
| InChI | InChI=1S/C10H13N3OS2/c15-9-8-7(1-2-11-9)12-10(16-8)13-3-5-14-6-4-13/h1-6H2,(H,11,15) |
| InChIKey | WLELKTCJIMCYKE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|