About 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide
7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide (PubChem CID 87302276) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide.
Molecular Properties
| Compound Name | 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
| PubChem CID | 87302276 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
| SMILES | COc1ccc2c(c1)OCCN2C(N)=S |
| InChI | InChI=1S/C10H12N2O2S/c1-13-7-2-3-8-9(6-7)14-5-4-12(8)10(11)15/h2-3,6H,4-5H2,1H3,(H2,11,15) |
| InChIKey | FSDZUFPNFJYWLR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide?
The IUPAC name of 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide (CID 87302276) is 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide.
What is the SMILES notation for 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide?
The canonical SMILES for 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide is COc1ccc2c(c1)OCCN2C(N)=S.
What is the InChIKey of 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide?
The InChIKey is FSDZUFPNFJYWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-13-7-2-3-8-9(6-7)14-5-4-12(8)10(11)15/h2-3,6H,4-5H2,1H3,(H2,11,15).
What are the key properties of 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide?
7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide has a molecular weight of 224.28 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,3-dihydro-1,4-benzoxazine-4-carbothioamide is sourced from PubChem (CID 87302276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).