C36H32BBrF6N4O2 — CID 87302327
4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]indazole (PubChem CID 87302327) has the molecular formula C36H32BBrF6N4O2 and a molecular weight of 757.38 g/mol. Its IUPAC name is 4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]indazole.
| Compound Name | 4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
|---|---|
| PubChem CID | 87302327 |
| Molecular Formula | C36H32BBrF6N4O2 |
| Molecular Weight | 757.38 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | 4-bromo-2-[[3-(trifluoromethyl)phenyl]methyl]indazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[3-(trifluoromethyl)phenyl]methyl]indazole |
| SMILES | CC1(C)OB(c2cccc3nn(Cc4cccc(C(F)(F)F)c4)cc23)OC1(C)C.FC(F)(F)c1cccc(Cn2cc3c(Br)cccc3n2)c1 |
| InChI | InChI=1S/C21H22BF3N2O2.C15H10BrF3N2/c1-19(2)20(3,4)29-22(28-19)17-9-6-10-18-16(17)13-27(26-18)12-14-7-5-8-15(11-14)21(23,24)25;16-13-5-2-6-14-12(13)9-21(20-14)8-10-3-1-4-11(7-10)15(17,18)19/h5-11,13H,12H2,1-4H3;1-7,9H,8H2 |
| InChIKey | GBLUTRJVBGXCLM-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.38 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|