C13H7F17N2 — CID 87302890
1-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole (PubChem CID 87302890) has the molecular formula C13H7F17N2 and a molecular weight of 514.18 g/mol. Its IUPAC name is 1-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole.
| Compound Name | 1-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole |
|---|---|
| PubChem CID | 87302890 |
| Molecular Formula | C13H7F17N2 |
| Molecular Weight | 514.18 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 1-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)imidazole |
| SMILES | FC(F)C(F)(F)CCn1ccnc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H7F17N2/c14-5(15)7(16,17)1-3-32-4-2-31-6(32)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h2,4-5H,1,3H2 |
| InChIKey | PRMOCKDOXMKKFR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.18 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|