C34H53N3O4 — CID 87303012
3-[[1-cyclohexyl-3-(3-methylbutylamino)propan-2-yl]amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 87303012) has the molecular formula C34H53N3O4 and a molecular weight of 567.82 g/mol. Its IUPAC name is 3-[[1-cyclohexyl-3-(3-methylbutylamino)propan-2-yl]amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[1-cyclohexyl-3-(3-methylbutylamino)propan-2-yl]amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87303012 |
| Molecular Formula | C34H53N3O4 |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.40 |
| IUPAC Name | 3-[[1-cyclohexyl-3-(3-methylbutylamino)propan-2-yl]amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | COCCCO[C@@H](c1ccccc1)C1CCCN(c2c(NC(CNCCC(C)C)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C34H53N3O4/c1-25(2)17-18-35-23-29(22-26-12-6-4-7-13-26)36-30-31(33(39)32(30)38)37-19-10-16-28(24-37)34(41-21-11-20-40-3)27-14-8-5-9-15-27/h5,8-9,14-15,25-26,28-29,34-36H,4,6-7,10-13,16-24H2,1-3H3/t28?,29?,34-/m0/s1 |
| InChIKey | PGCVISSCMLNJST-HTPHQJRUSA-N |
| XLogP | 5.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|