About 4,5-diethynyl-1,3-dithiolane
4,5-diethynyl-1,3-dithiolane (PubChem CID 87303032) has the molecular formula C7H6S2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 4,5-diethynyl-1,3-dithiolane.
Molecular Properties
| Compound Name | 4,5-diethynyl-1,3-dithiolane |
| PubChem CID | 87303032 |
| Molecular Formula | C7H6S2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | 4,5-diethynyl-1,3-dithiolane |
| SMILES | C#CC1SCSC1C#C |
| InChI | InChI=1S/C7H6S2/c1-3-6-7(4-2)9-5-8-6/h1-2,6-7H,5H2 |
| InChIKey | IPVBQQJXXOGWOV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethynyl-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethynyl-1,3-dithiolane?
The IUPAC name of 4,5-diethynyl-1,3-dithiolane (CID 87303032) is 4,5-diethynyl-1,3-dithiolane.
What is the SMILES notation for 4,5-diethynyl-1,3-dithiolane?
The canonical SMILES for 4,5-diethynyl-1,3-dithiolane is C#CC1SCSC1C#C.
What is the InChIKey of 4,5-diethynyl-1,3-dithiolane?
The InChIKey is IPVBQQJXXOGWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6S2/c1-3-6-7(4-2)9-5-8-6/h1-2,6-7H,5H2.
What are the key properties of 4,5-diethynyl-1,3-dithiolane?
4,5-diethynyl-1,3-dithiolane has a molecular weight of 154.26 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethynyl-1,3-dithiolane is sourced from PubChem (CID 87303032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).