About [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate
[(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate (PubChem CID 87303128) has the molecular formula C9H18N2O4
and a molecular weight of 218.25 g/mol. Its IUPAC name is [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate.
Molecular Properties
| Compound Name | [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate |
| PubChem CID | 87303128 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate |
| SMILES | CNC(=O)[C@@H](OC(N)=O)C(O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O4/c1-9(2,3)6(12)5(7(13)11-4)15-8(10)14/h5-6,12H,1-4H3,(H2,10,14)(H,11,13)/t5-,6?/m0/s1 |
| InChIKey | SFUZHTUETPIMGN-ZBHICJROSA-N |
| XLogP | -0.40 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate?
The IUPAC name of [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate (CID 87303128) is [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate.
What is the SMILES notation for [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate?
The canonical SMILES for [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate is CNC(=O)[C@@H](OC(N)=O)C(O)C(C)(C)C.
What is the InChIKey of [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate?
The InChIKey is SFUZHTUETPIMGN-ZBHICJROSA-N. The full InChI is InChI=1S/C9H18N2O4/c1-9(2,3)6(12)5(7(13)11-4)15-8(10)14/h5-6,12H,1-4H3,(H2,10,14)(H,11,13)/t5-,6?/m0/s1.
What are the key properties of [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate?
[(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate has a molecular weight of 218.25 g/mol, XLogP of -0.40, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-hydroxy-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl] carbamate is sourced from PubChem (CID 87303128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).