C2HF4NaO3S — CID 87303205
sodium 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87303205) has the molecular formula C2HF4NaO3S and a molecular weight of 204.08 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87303205 |
| Molecular Formula | C2HF4NaO3S |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 203.95 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)F.[Na+] |
| InChI | InChI=1S/C2H2F4O3S.Na/c3-1(4)2(5,6)10(7,8)9;/h1H,(H,7,8,9);/q;+1/p-1 |
| InChIKey | AXAQAFNUTNNQEA-UHFFFAOYSA-M |
| XLogP | -2.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|