C29H43N3O4 — CID 87303382
3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 87303382) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87303382 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | COCCCO[C@@H](c1ccccc1)C1CCCN(c2c(NC(CN)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C29H43N3O4/c1-35-16-9-17-36-29(22-12-6-3-7-13-22)23-14-8-15-32(20-23)26-25(27(33)28(26)34)31-24(19-30)18-21-10-4-2-5-11-21/h3,6-7,12-13,21,23-24,29,31H,2,4-5,8-11,14-20,30H2,1H3/t23?,24?,29-/m0/s1 |
| InChIKey | FYIBERUOPFLGHF-DHCVZJGKSA-N |
| XLogP | 4.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|