C5H9NO5S2 — CID 87303443
N-(1,1,3,3-tetraoxo-1,3-dithiolan-4-yl)acetamide (PubChem CID 87303443) has the molecular formula C5H9NO5S2 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(1,1,3,3-tetraoxo-1,3-dithiolan-4-yl)acetamide.
| Compound Name | N-(1,1,3,3-tetraoxo-1,3-dithiolan-4-yl)acetamide |
|---|---|
| PubChem CID | 87303443 |
| Molecular Formula | C5H9NO5S2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | N-(1,1,3,3-tetraoxo-1,3-dithiolan-4-yl)acetamide |
| SMILES | CC(=O)NC1CS(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C5H9NO5S2/c1-4(7)6-5-2-12(8,9)3-13(5,10)11/h5H,2-3H2,1H3,(H,6,7) |
| InChIKey | VRANFMBQYOUREZ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |