C32H32F7N3O5 — CID 87303841
ethyl 3-[5-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoyl]-methylamino]-4-(4-fluoro-2-methylphenyl)-2-pyridinyl]-4-nitropentanoate (PubChem CID 87303841) has the molecular formula C32H32F7N3O5 and a molecular weight of 671.61 g/mol. Its IUPAC name is ethyl 3-[5-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoyl]-methylamino]-4-(4-fluoro-2-methylphenyl)-2-pyridinyl]-4-nitropentanoate.
| Compound Name | ethyl 3-[5-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoyl]-methylamino]-4-(4-fluoro-2-methylphenyl)-2-pyridinyl]-4-nitropentanoate |
|---|---|
| PubChem CID | 87303841 |
| Molecular Formula | C32H32F7N3O5 |
| Molecular Weight | 671.61 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | ethyl 3-[5-[[2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoyl]-methylamino]-4-(4-fluoro-2-methylphenyl)-2-pyridinyl]-4-nitropentanoate |
| SMILES | CCOC(=O)CC(c1cc(-c2ccc(F)cc2C)c(N(C)C(=O)C(C)(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C32H32F7N3O5/c1-7-47-28(43)15-24(18(3)42(45)46)26-14-25(23-9-8-22(33)10-17(23)2)27(16-40-26)41(6)29(44)30(4,5)19-11-20(31(34,35)36)13-21(12-19)32(37,38)39/h8-14,16,18,24H,7,15H2,1-6H3 |
| InChIKey | HWIGMXVQVWKSQR-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.61 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|