C34H13F34P — CID 87303958
[2,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]phenyl]phosphane (PubChem CID 87303958) has the molecular formula C34H13F34P and a molecular weight of 1098.38 g/mol. Its IUPAC name is [2,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]phenyl]phosphane.
| Compound Name | [2,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 87303958 |
| Molecular Formula | C34H13F34P |
| Molecular Weight | 1098.38 g/mol |
| Exact Mass | 1098.02 |
| IUPAC Name | [2,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]phenyl]phosphane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(-c2cccc(P)c2-c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H13F34P/c35-19(36,21(39,40)23(43,44)25(47,48)27(51,52)29(55,56)31(59,60)33(63,64)65)14-8-4-12(5-9-14)16-2-1-3-17(69)18(16)13-6-10-15(11-7-13)20(37,38)22(41,42)24(45,46)26(49,50)28(53,54)30(57,58)32(61,62)34(66,67)68/h1-11H,69H2 |
| InChIKey | BWPZLJQQIJUTTD-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.38 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|