C30H45N3O4 — CID 87304087
3-[[(2S)-1-amino-3-cyclohexylpropan-2-yl]-methylamino]-4-[(3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 87304087) has the molecular formula C30H45N3O4 and a molecular weight of 511.71 g/mol. Its IUPAC name is 3-[[(2S)-1-amino-3-cyclohexylpropan-2-yl]-methylamino]-4-[(3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(2S)-1-amino-3-cyclohexylpropan-2-yl]-methylamino]-4-[(3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87304087 |
| Molecular Formula | C30H45N3O4 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | 3-[[(2S)-1-amino-3-cyclohexylpropan-2-yl]-methylamino]-4-[(3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | COCCCOC(c1ccccc1)[C@@H]1CCCN(c2c(N(C)[C@H](CN)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C30H45N3O4/c1-32(25(20-31)19-22-11-5-3-6-12-22)26-27(29(35)28(26)34)33-16-9-15-24(21-33)30(37-18-10-17-36-2)23-13-7-4-8-14-23/h4,7-8,13-14,22,24-25,30H,3,5-6,9-12,15-21,31H2,1-2H3/t24-,25+,30?/m1/s1 |
| InChIKey | KSLMQMYEMAZUKJ-SVYDGNIISA-N |
| XLogP | 4.03 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|