About 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea
1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea (PubChem CID 87304163) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea |
| PubChem CID | 87304163 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea |
| SMILES | CC(C)CN(C)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(2)8-13(7)12(15)14(10(3)4)11(5)6/h9-11H,8H2,1-7H3 |
| InChIKey | QEXLZKVNBHKGIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea?
The IUPAC name of 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea (CID 87304163) is 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea.
What is the SMILES notation for 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea?
The canonical SMILES for 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea is CC(C)CN(C)C(=O)N(C(C)C)C(C)C.
What is the InChIKey of 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea?
The InChIKey is QEXLZKVNBHKGIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-9(2)8-13(7)12(15)14(10(3)4)11(5)6/h9-11H,8H2,1-7H3.
What are the key properties of 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea?
1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea has a molecular weight of 214.35 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(2-methylpropyl)-3,3-di(propan-2-yl)urea is sourced from PubChem (CID 87304163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).