About 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine
1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine (PubChem CID 87304834) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine.
Molecular Properties
| Compound Name | 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine |
| PubChem CID | 87304834 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine |
| SMILES | [H]/N=C(\N(C)C)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H25N3/c1-9(2)7-14(8-10(3)4)11(12)13(5)6/h9-10,12H,7-8H2,1-6H3/b12-11+ |
| InChIKey | PCTUUEIGKFFQAR-VAWYXSNFSA-N |
| XLogP | 2.10 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine?
The IUPAC name of 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine (CID 87304834) is 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine.
What is the SMILES notation for 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine?
The canonical SMILES for 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine is [H]/N=C(\N(C)C)N(CC(C)C)CC(C)C.
What is the InChIKey of 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine?
The InChIKey is PCTUUEIGKFFQAR-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H25N3/c1-9(2)7-14(8-10(3)4)11(12)13(5)6/h9-10,12H,7-8H2,1-6H3/b12-11+.
What are the key properties of 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine?
1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine has a molecular weight of 199.34 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3,3-bis(2-methylpropyl)guanidine is sourced from PubChem (CID 87304834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).