About [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate
[(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate (PubChem CID 87305054) has the molecular formula C8H17NO6S2
and a molecular weight of 287.36 g/mol. Its IUPAC name is [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate |
| PubChem CID | 87305054 |
| Molecular Formula | C8H17NO6S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate |
| SMILES | CC(C)S(=O)(=O)N[C@H]1COC[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C8H17NO6S2/c1-6(2)17(12,13)9-7-4-14-5-8(7)15-16(3,10)11/h6-9H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | BAOGLMWHCJMVMI-YUMQZZPRSA-N |
| XLogP | -0.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate?
The IUPAC name of [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate (CID 87305054) is [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate.
What is the SMILES notation for [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate?
The canonical SMILES for [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate is CC(C)S(=O)(=O)N[C@H]1COC[C@@H]1OS(C)(=O)=O.
What is the InChIKey of [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate?
The InChIKey is BAOGLMWHCJMVMI-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H17NO6S2/c1-6(2)17(12,13)9-7-4-14-5-8(7)15-16(3,10)11/h6-9H,4-5H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate?
[(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate has a molecular weight of 287.36 g/mol, XLogP of -0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(propan-2-ylsulfonylamino)oxolan-3-yl] methanesulfonate is sourced from PubChem (CID 87305054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).