C23H26F6N2O2 — CID 87305550
5-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pentanamide (PubChem CID 87305550) has the molecular formula C23H26F6N2O2 and a molecular weight of 476.46 g/mol. Its IUPAC name is 5-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pentanamide.
| Compound Name | 5-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pentanamide |
|---|---|
| PubChem CID | 87305550 |
| Molecular Formula | C23H26F6N2O2 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 5-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropyl]pentanamide |
| SMILES | NCCCCC(=O)NCC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H26F6N2O2/c24-22(25,26)19-10-16(11-20(12-19)23(27,28)29)14-33-15-18(17-6-2-1-3-7-17)13-31-21(32)8-4-5-9-30/h1-3,6-7,10-12,18H,4-5,8-9,13-15,30H2,(H,31,32) |
| InChIKey | CNCSNQVMOHPTII-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|