C7H6O6 — CID 87305809
3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 87305809) has the molecular formula C7H6O6 and a molecular weight of 186.12 g/mol. Its IUPAC name is 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 87305809 |
| Molecular Formula | C7H6O6 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C12C=C(O)C(O)=C(O)C1O2 |
| InChI | InChI=1S/C7H6O6/c8-2-1-7(6(11)12)5(13-7)4(10)3(2)9/h1,5,8-10H,(H,11,12) |
| InChIKey | BSTMHRDAIMVMSA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|