C29H40ClN5O4Si — CID 87306461
methyl N-[(2S)-1-[2-[4-(2-chloroquinolin-6-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 87306461) has the molecular formula C29H40ClN5O4Si and a molecular weight of 586.21 g/mol. Its IUPAC name is methyl N-[(2S)-1-[2-[4-(2-chloroquinolin-6-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[2-[4-(2-chloroquinolin-6-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87306461 |
| Molecular Formula | C29H40ClN5O4Si |
| Molecular Weight | 586.21 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | methyl N-[(2S)-1-[2-[4-(2-chloroquinolin-6-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCCC1c1nc(-c2ccc3nc(Cl)ccc3c2)cn1COCC[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C29H40ClN5O4Si/c1-19(2)26(33-29(37)38-3)28(36)35-13-7-8-24(35)27-32-23(17-34(27)18-39-14-15-40(4,5)6)21-9-11-22-20(16-21)10-12-25(30)31-22/h9-12,16-17,19,24,26H,7-8,13-15,18H2,1-6H3,(H,33,37)/t24?,26-/m0/s1 |
| InChIKey | PMRFUIPXSKVHDU-JKGBFCRXSA-N |
| XLogP | 6.11 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.21 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|