C11HF17O — CID 87306618
1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)adamantan-2-ol (PubChem CID 87306618) has the molecular formula C11HF17O and a molecular weight of 472.09 g/mol. Its IUPAC name is 1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)adamantan-2-ol.
| Compound Name | 1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)adamantan-2-ol |
|---|---|
| PubChem CID | 87306618 |
| Molecular Formula | C11HF17O |
| Molecular Weight | 472.09 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-(trifluoromethyl)adamantan-2-ol |
| SMILES | OC1(C(F)(F)F)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C11HF17O/c12-1-5(29,11(26,27)28)2(13)8(20,21)3(14,6(1,16)17)10(24,25)4(15,7(1,18)19)9(2,22)23/h29H |
| InChIKey | FZDOKOOSTKCYDW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |