C18H23NO4S — CID 87306746
benzenesulfonyl 2-[(1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 87306746) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is benzenesulfonyl 2-[(1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | benzenesulfonyl 2-[(1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 87306746 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | benzenesulfonyl 2-[(1S,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CCC1=C[C@@H]2[C@@H](C1)C[C@]2(CN)CC(=O)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO4S/c1-2-13-8-14-10-18(12-19,16(14)9-13)11-17(20)23-24(21,22)15-6-4-3-5-7-15/h3-7,9,14,16H,2,8,10-12,19H2,1H3/t14-,16+,18+/m0/s1 |
| InChIKey | INIHXZTVBZFOLY-YXJHDRRASA-N |
| XLogP | 2.63 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|