C15H22N2O3S — CID 87306797
3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propane-1-sulfonic acid (PubChem CID 87306797) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87306797 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]propane-1-sulfonic acid |
| SMILES | Cc1cc(C)c(N2C=CN(CCCS(=O)(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12-9-13(2)15(14(3)10-12)17-7-6-16(11-17)5-4-8-21(18,19)20/h6-7,9-10H,4-5,8,11H2,1-3H3,(H,18,19,20) |
| InChIKey | CXPAFTJYWAANLJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|