C14H4F22N2O2 — CID 87306997
2-[[3-(2-amino-1,1,2,2-tetrafluoroethoxy)-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-1-adamantyl]oxy]-1,1,2,2-tetrafluoroethanamine (PubChem CID 87306997) has the molecular formula C14H4F22N2O2 and a molecular weight of 650.15 g/mol. Its IUPAC name is 2-[[3-(2-amino-1,1,2,2-tetrafluoroethoxy)-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-1-adamantyl]oxy]-1,1,2,2-tetrafluoroethanamine.
| Compound Name | 2-[[3-(2-amino-1,1,2,2-tetrafluoroethoxy)-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-1-adamantyl]oxy]-1,1,2,2-tetrafluoroethanamine |
|---|---|
| PubChem CID | 87306997 |
| Molecular Formula | C14H4F22N2O2 |
| Molecular Weight | 650.15 g/mol |
| Exact Mass | 649.99 |
| IUPAC Name | 2-[[3-(2-amino-1,1,2,2-tetrafluoroethoxy)-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-1-adamantyl]oxy]-1,1,2,2-tetrafluoroethanamine |
| SMILES | NC(F)(F)C(F)(F)OC12C(F)(F)C3(F)C(F)(F)C(F)(C1(F)F)C(F)(F)C(OC(F)(F)C(N)(F)F)(C3(F)F)C2(F)F |
| InChI | InChI=1S/C14H4F22N2O2/c15-1-5(17,18)2(16)8(23,24)3(6(1,19)20,39-13(33,34)11(29,30)37)10(27,28)4(7(1,21)22,9(2,25)26)40-14(35,36)12(31,32)38/h37-38H2 |
| InChIKey | DRMNYOOBAQYEAF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.15 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|