C13H8F15NO — CID 87307109
1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]propan-2-amine (PubChem CID 87307109) has the molecular formula C13H8F15NO and a molecular weight of 479.18 g/mol. Its IUPAC name is 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]propan-2-amine.
| Compound Name | 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]propan-2-amine |
|---|---|
| PubChem CID | 87307109 |
| Molecular Formula | C13H8F15NO |
| Molecular Weight | 479.18 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]propan-2-amine |
| SMILES | CC(N)COC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C13H8F15NO/c1-3(29)2-30-7-11(23,24)4(14)8(17,18)5(15,12(7,25)26)10(21,22)6(16,9(4,19)20)13(7,27)28/h3H,2,29H2,1H3 |
| InChIKey | YQHDNSLLYXFZHA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |