C13F22O3 — CID 87307349
[1,1,2,3,3-pentafluoro-1-fluorooxy-3-[(1,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-2-adamantyl)oxy]propan-2-yl] hypofluorite (PubChem CID 87307349) has the molecular formula C13F22O3 and a molecular weight of 622.10 g/mol. Its IUPAC name is [1,1,2,3,3-pentafluoro-1-fluorooxy-3-[(1,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-2-adamantyl)oxy]propan-2-yl] hypofluorite.
| Compound Name | [1,1,2,3,3-pentafluoro-1-fluorooxy-3-[(1,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-2-adamantyl)oxy]propan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 87307349 |
| Molecular Formula | C13F22O3 |
| Molecular Weight | 622.10 g/mol |
| Exact Mass | 621.95 |
| IUPAC Name | [1,1,2,3,3-pentafluoro-1-fluorooxy-3-[(1,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-2-adamantyl)oxy]propan-2-yl] hypofluorite |
| SMILES | FOC(F)(F)C(F)(OF)C(F)(F)OC1(F)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C13F22O3/c14-1-5(18,19)2(15)8(24,25)3(16,6(1,20)21)10(28,4(17,7(1,22)23)9(2,26)27)36-12(30,31)11(29,37-34)13(32,33)38-35 |
| InChIKey | WWYSJYDVDRPTKD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.10 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |