C14H10F15NO — CID 87307412
1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]butan-2-amine (PubChem CID 87307412) has the molecular formula C14H10F15NO and a molecular weight of 493.21 g/mol. Its IUPAC name is 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]butan-2-amine.
| Compound Name | 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]butan-2-amine |
|---|---|
| PubChem CID | 87307412 |
| Molecular Formula | C14H10F15NO |
| Molecular Weight | 493.21 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 1-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]butan-2-amine |
| SMILES | CCC(N)COC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C14H10F15NO/c1-2-4(30)3-31-8-12(24,25)5(15)9(18,19)6(16,13(8,26)27)11(22,23)7(17,10(5,20)21)14(8,28)29/h4H,2-3,30H2,1H3 |
| InChIKey | FZOVHKSZMPNRRD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |