C12F21NO — CID 87307634
N,N,1,1,2,2-hexafluoro-2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethanamine (PubChem CID 87307634) has the molecular formula C12F21NO and a molecular weight of 573.10 g/mol. Its IUPAC name is N,N,1,1,2,2-hexafluoro-2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethanamine.
| Compound Name | N,N,1,1,2,2-hexafluoro-2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethanamine |
|---|---|
| PubChem CID | 87307634 |
| Molecular Formula | C12F21NO |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.96 |
| IUPAC Name | N,N,1,1,2,2-hexafluoro-2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxy]ethanamine |
| SMILES | FN(F)C(F)(F)C(F)(F)OC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
| InChI | InChI=1S/C12F21NO/c13-1-5(16,17)2(14)7(20,21)3(15,6(1,18)19)10(26,27)4(8(1,22)23,9(2,24)25)35-12(30,31)11(28,29)34(32)33 |
| InChIKey | NBVGAZRXHXMMDY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|