C17H18ClN5O2S — CID 87307750
1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(5-ethyl-1,3-oxazol-2-yl)ethyl]urea (PubChem CID 87307750) has the molecular formula C17H18ClN5O2S and a molecular weight of 391.88 g/mol. Its IUPAC name is 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(5-ethyl-1,3-oxazol-2-yl)ethyl]urea.
| Compound Name | 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(5-ethyl-1,3-oxazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 87307750 |
| Molecular Formula | C17H18ClN5O2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(5-ethyl-1,3-oxazol-2-yl)ethyl]urea |
| SMILES | CCc1cnc(CCNC(=O)Nc2nc(C)c(-c3ccnc(Cl)c3)s2)o1 |
| InChI | InChI=1S/C17H18ClN5O2S/c1-3-12-9-21-14(25-12)5-7-20-16(24)23-17-22-10(2)15(26-17)11-4-6-19-13(18)8-11/h4,6,8-9H,3,5,7H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | KGQKLBDFSVFJDG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|