C15H17N3O6 — CID 87307774
propanedioic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87307774) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is propanedioic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | propanedioic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87307774 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | propanedioic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C(O)CC(=O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C3H4O4/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;4-2(5)1-3(6)7/h7H,1-6H2;1H2,(H,4,5)(H,6,7) |
| InChIKey | STRHHNFIAGZDOE-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|