C10H21NO6 — CID 87308280
5-(2,4,5-trihydroxypentylideneamino)pentane-1,2,4-triol (PubChem CID 87308280) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(2,4,5-trihydroxypentylideneamino)pentane-1,2,4-triol.
| Compound Name | 5-(2,4,5-trihydroxypentylideneamino)pentane-1,2,4-triol |
|---|---|
| PubChem CID | 87308280 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 5-(2,4,5-trihydroxypentylideneamino)pentane-1,2,4-triol |
| SMILES | OCC(O)CC(O)/C=N/CC(O)CC(O)CO |
| InChI | InChI=1S/C10H21NO6/c12-5-9(16)1-7(14)3-11-4-8(15)2-10(17)6-13/h3,7-10,12-17H,1-2,4-6H2/b11-3+ |
| InChIKey | QYSPFNWVNJMUCN-QDEBKDIKSA-N |
| XLogP | -2.73 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|