C14H19ClN4O3S2 — CID 8730830
1-[[2-[(4-chlorophenyl)sulfonyl-methylamino]acetyl]amino]-3-(2-methylprop-2-enyl)thiourea (PubChem CID 8730830) has the molecular formula C14H19ClN4O3S2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-[[2-[(4-chlorophenyl)sulfonyl-methylamino]acetyl]amino]-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-[[2-[(4-chlorophenyl)sulfonyl-methylamino]acetyl]amino]-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 8730830 |
| Molecular Formula | C14H19ClN4O3S2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-[[2-[(4-chlorophenyl)sulfonyl-methylamino]acetyl]amino]-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NNC(=O)CN(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN4O3S2/c1-10(2)8-16-14(23)18-17-13(20)9-19(3)24(21,22)12-6-4-11(15)5-7-12/h4-7H,1,8-9H2,2-3H3,(H,17,20)(H2,16,18,23) |
| InChIKey | ZCVCJDKSDBQUDO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|